C19H33N3O3 — CID 86965968
5,5-diethyl-3-[2-(5-methyl-2-propan-2-ylazepan-1-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 86965968) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 5,5-diethyl-3-[2-(5-methyl-2-propan-2-ylazepan-1-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[2-(5-methyl-2-propan-2-ylazepan-1-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86965968 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 5,5-diethyl-3-[2-(5-methyl-2-propan-2-ylazepan-1-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N2CCC(C)CCC2C(C)C)C1=O |
| InChI | InChI=1S/C19H33N3O3/c1-6-19(7-2)17(24)22(18(25)20-19)12-16(23)21-11-10-14(5)8-9-15(21)13(3)4/h13-15H,6-12H2,1-5H3,(H,20,25) |
| InChIKey | XBPXRRHDQCIEKK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|