C25H27N3O4 — CID 86966309
N-[2-[[1-(2-methoxyphenyl)piperidin-3-yl]carbamoyl]phenyl]-N-methylfuran-2-carboxamide (PubChem CID 86966309) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[2-[[1-(2-methoxyphenyl)piperidin-3-yl]carbamoyl]phenyl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[2-[[1-(2-methoxyphenyl)piperidin-3-yl]carbamoyl]phenyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 86966309 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[2-[[1-(2-methoxyphenyl)piperidin-3-yl]carbamoyl]phenyl]-N-methylfuran-2-carboxamide |
| SMILES | COc1ccccc1N1CCCC(NC(=O)c2ccccc2N(C)C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C25H27N3O4/c1-27(25(30)23-14-8-16-32-23)20-11-4-3-10-19(20)24(29)26-18-9-7-15-28(17-18)21-12-5-6-13-22(21)31-2/h3-6,8,10-14,16,18H,7,9,15,17H2,1-2H3,(H,26,29) |
| InChIKey | SKQUGEZNRFWXLS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |