C16H14F3NO4 — CID 86967729
[2-(2,2,2-trifluoroethoxy)phenyl] 2-ethoxypyridine-4-carboxylate (PubChem CID 86967729) has the molecular formula C16H14F3NO4 and a molecular weight of 341.29 g/mol. Its IUPAC name is [2-(2,2,2-trifluoroethoxy)phenyl] 2-ethoxypyridine-4-carboxylate.
| Compound Name | [2-(2,2,2-trifluoroethoxy)phenyl] 2-ethoxypyridine-4-carboxylate |
|---|---|
| PubChem CID | 86967729 |
| Molecular Formula | C16H14F3NO4 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [2-(2,2,2-trifluoroethoxy)phenyl] 2-ethoxypyridine-4-carboxylate |
| SMILES | CCOc1cc(C(=O)Oc2ccccc2OCC(F)(F)F)ccn1 |
| InChI | InChI=1S/C16H14F3NO4/c1-2-22-14-9-11(7-8-20-14)15(21)24-13-6-4-3-5-12(13)23-10-16(17,18)19/h3-9H,2,10H2,1H3 |
| InChIKey | FJJHJHIBTCESGZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|