C24H33N5O — CID 86968889
1-benzyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 86968889) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-benzyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-benzyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 86968889 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 1-benzyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(CN1CCN(c2ccccn2)CC1)NC(=O)C1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C24H33N5O/c1-20(18-27-14-16-28(17-15-27)23-11-5-6-12-25-23)26-24(30)22-10-7-13-29(22)19-21-8-3-2-4-9-21/h2-6,8-9,11-12,20,22H,7,10,13-19H2,1H3,(H,26,30) |
| InChIKey | YFYWECZBOABYFS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |