C20H25ClN4O3S — CID 86968929
4-chloro-3-methylsulfonyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzamide (PubChem CID 86968929) has the molecular formula C20H25ClN4O3S and a molecular weight of 436.97 g/mol. Its IUPAC name is 4-chloro-3-methylsulfonyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzamide.
| Compound Name | 4-chloro-3-methylsulfonyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 86968929 |
| Molecular Formula | C20H25ClN4O3S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-chloro-3-methylsulfonyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzamide |
| SMILES | CC(CN1CCN(c2ccccn2)CC1)NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H25ClN4O3S/c1-15(14-24-9-11-25(12-10-24)19-5-3-4-8-22-19)23-20(26)16-6-7-17(21)18(13-16)29(2,27)28/h3-8,13,15H,9-12,14H2,1-2H3,(H,23,26) |
| InChIKey | BUJXHXQWSBJRBJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |