C23H29FN4O2 — CID 86969723
4-[4-[2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]-2-oxoethyl]piperazin-1-yl]benzamide (PubChem CID 86969723) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 4-[4-[2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]-2-oxoethyl]piperazin-1-yl]benzamide.
| Compound Name | 4-[4-[2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]-2-oxoethyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 86969723 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 4-[4-[2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]-2-oxoethyl]piperazin-1-yl]benzamide |
| SMILES | CCN(C(=O)CN1CCN(c2ccc(C(N)=O)cc2)CC1)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29FN4O2/c1-3-28(17(2)18-4-8-20(24)9-5-18)22(29)16-26-12-14-27(15-13-26)21-10-6-19(7-11-21)23(25)30/h4-11,17H,3,12-16H2,1-2H3,(H2,25,30) |
| InChIKey | YKYRWNRCOLMWNH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |