About 2-ethylhexanoic acid
2-ethylhexanoic acid (PubChem CID 8697) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2-ethylhexanoic acid.
Molecular Properties
| Compound Name | 2-ethylhexanoic acid |
| PubChem CID | 8697 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2-ethylhexanoic acid |
| SMILES | CCCCC(CC)C(=O)O |
| InChI | InChI=1S/C8H16O2/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | OBETXYAYXDNJHR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoic acid?
The IUPAC name of 2-ethylhexanoic acid (CID 8697) is 2-ethylhexanoic acid.
What is the SMILES notation for 2-ethylhexanoic acid?
The canonical SMILES for 2-ethylhexanoic acid is CCCCC(CC)C(=O)O.
What is the InChIKey of 2-ethylhexanoic acid?
The InChIKey is OBETXYAYXDNJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 2-ethylhexanoic acid?
2-ethylhexanoic acid has a molecular weight of 144.21 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoic acid is sourced from PubChem (CID 8697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).