C20H21NO2 — CID 869711
(5R)-3-(2-ethoxyanilino)-5-phenylcyclohex-2-en-1-one (PubChem CID 869711) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (5R)-3-(2-ethoxyanilino)-5-phenylcyclohex-2-en-1-one.
| Compound Name | (5R)-3-(2-ethoxyanilino)-5-phenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 869711 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (5R)-3-(2-ethoxyanilino)-5-phenylcyclohex-2-en-1-one |
| SMILES | CCOc1ccccc1NC1=CC(=O)C[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H21NO2/c1-2-23-20-11-7-6-10-19(20)21-17-12-16(13-18(22)14-17)15-8-4-3-5-9-15/h3-11,14,16,21H,2,12-13H2,1H3/t16-/m1/s1 |
| InChIKey | RDCGPRDARLEINQ-MRXNPFEDSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |