C25H30N2O3 — CID 86971115
(E)-3-(4-morpholin-4-ylphenyl)-1-[3-(phenoxymethyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 86971115) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is (E)-3-(4-morpholin-4-ylphenyl)-1-[3-(phenoxymethyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-morpholin-4-ylphenyl)-1-[3-(phenoxymethyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 86971115 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (E)-3-(4-morpholin-4-ylphenyl)-1-[3-(phenoxymethyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(N2CCOCC2)cc1)N1CCCC(COc2ccccc2)C1 |
| InChI | InChI=1S/C25H30N2O3/c28-25(13-10-21-8-11-23(12-9-21)26-15-17-29-18-16-26)27-14-4-5-22(19-27)20-30-24-6-2-1-3-7-24/h1-3,6-13,22H,4-5,14-20H2/b13-10+ |
| InChIKey | GQUZULMCQLCLMV-JLHYYAGUSA-N |
| XLogP | 3.85 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|