C17H18BrNO3S2 — CID 86971404
2-(4-bromophenyl)sulfanyl-N-(3-ethylsulfonylphenyl)propanamide (PubChem CID 86971404) has the molecular formula C17H18BrNO3S2 and a molecular weight of 428.37 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(3-ethylsulfonylphenyl)propanamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(3-ethylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 86971404 |
| Molecular Formula | C17H18BrNO3S2 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(3-ethylsulfonylphenyl)propanamide |
| SMILES | CCS(=O)(=O)c1cccc(NC(=O)C(C)Sc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H18BrNO3S2/c1-3-24(21,22)16-6-4-5-14(11-16)19-17(20)12(2)23-15-9-7-13(18)8-10-15/h4-12H,3H2,1-2H3,(H,19,20) |
| InChIKey | SFMVFFKJCLFYMT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |