C26H32N2O2 — CID 86971881
N-[4-[2,3-dihydro-1H-indene-5-carbonyl(methyl)amino]butyl]-N-methyl-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 86971881) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-[4-[2,3-dihydro-1H-indene-5-carbonyl(methyl)amino]butyl]-N-methyl-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-[4-[2,3-dihydro-1H-indene-5-carbonyl(methyl)amino]butyl]-N-methyl-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 86971881 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-[4-[2,3-dihydro-1H-indene-5-carbonyl(methyl)amino]butyl]-N-methyl-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | CN(CCCCN(C)C(=O)c1ccc2c(c1)CCC2)C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C26H32N2O2/c1-27(25(29)23-13-11-19-7-5-9-21(19)17-23)15-3-4-16-28(2)26(30)24-14-12-20-8-6-10-22(20)18-24/h11-14,17-18H,3-10,15-16H2,1-2H3 |
| InChIKey | KMVOMXXHFLUREN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|