About Benzene, ((ethoxydimethylsilyl)methyl)-
Benzene, ((ethoxydimethylsilyl)methyl)- (PubChem CID 86972) has the molecular formula C11H18OSi
and a molecular weight of 194.34 g/mol. Its IUPAC name is benzyl-ethoxy-dimethylsilane.
Molecular Properties
| Compound Name | Benzene, ((ethoxydimethylsilyl)methyl)- |
| PubChem CID | 86972 |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | benzyl-ethoxy-dimethylsilane |
| SMILES | CCO[Si](C)(C)CC1=CC=CC=C1 |
| InChI | InChI=1S/C11H18OSi/c1-4-12-13(2,3)10-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3 |
| InChIKey | RFXODRCAZTVEOH-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | 139 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Benzene, ((ethoxydimethylsilyl)methyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzene, ((ethoxydimethylsilyl)methyl)-?
The IUPAC name of Benzene, ((ethoxydimethylsilyl)methyl)- (CID 86972) is benzyl-ethoxy-dimethylsilane.
What is the SMILES notation for Benzene, ((ethoxydimethylsilyl)methyl)-?
The canonical SMILES for Benzene, ((ethoxydimethylsilyl)methyl)- is CCO[Si](C)(C)CC1=CC=CC=C1.
What is the InChIKey of Benzene, ((ethoxydimethylsilyl)methyl)-?
The InChIKey is RFXODRCAZTVEOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OSi/c1-4-12-13(2,3)10-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3.
What are the key properties of Benzene, ((ethoxydimethylsilyl)methyl)-?
Benzene, ((ethoxydimethylsilyl)methyl)- has a molecular weight of 194.34 g/mol, XLogP of not available, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Benzene, ((ethoxydimethylsilyl)methyl)- is sourced from PubChem (CID 86972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).