C22H28N2O2 — CID 86972219
N-(2,3-dimethylphenyl)-2-[3-(phenoxymethyl)piperidin-1-yl]acetamide (PubChem CID 86972219) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[3-(phenoxymethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[3-(phenoxymethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 86972219 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[3-(phenoxymethyl)piperidin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCCC(COc3ccccc3)C2)c1C |
| InChI | InChI=1S/C22H28N2O2/c1-17-8-6-12-21(18(17)2)23-22(25)15-24-13-7-9-19(14-24)16-26-20-10-4-3-5-11-20/h3-6,8,10-12,19H,7,9,13-16H2,1-2H3,(H,23,25) |
| InChIKey | XBYYTSKPXHFOFN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |