C20H33N3O3 — CID 86972547
N-[(2-tert-butyloxan-3-yl)methyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 86972547) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is N-[(2-tert-butyloxan-3-yl)methyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-[(2-tert-butyloxan-3-yl)methyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86972547 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | N-[(2-tert-butyloxan-3-yl)methyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)C1OCCCC1CNC(=O)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C20H33N3O3/c1-20(2,3)18-16(6-4-13-26-18)14-21-19(24)23-10-8-22(9-11-23)15-17-7-5-12-25-17/h5,7,12,16,18H,4,6,8-11,13-15H2,1-3H3,(H,21,24) |
| InChIKey | BFSPQJVENQMYIQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |