C18H17F3N2O4S — CID 86973604
1-[2-[2-(trifluoromethyl)phenoxy]propanoyl]-2,3-dihydroindole-6-sulfonamide (PubChem CID 86973604) has the molecular formula C18H17F3N2O4S and a molecular weight of 414.41 g/mol. Its IUPAC name is 1-[2-[2-(trifluoromethyl)phenoxy]propanoyl]-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 1-[2-[2-(trifluoromethyl)phenoxy]propanoyl]-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 86973604 |
| Molecular Formula | C18H17F3N2O4S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 1-[2-[2-(trifluoromethyl)phenoxy]propanoyl]-2,3-dihydroindole-6-sulfonamide |
| SMILES | CC(Oc1ccccc1C(F)(F)F)C(=O)N1CCc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C18H17F3N2O4S/c1-11(27-16-5-3-2-4-14(16)18(19,20)21)17(24)23-9-8-12-6-7-13(10-15(12)23)28(22,25)26/h2-7,10-11H,8-9H2,1H3,(H2,22,25,26) |
| InChIKey | PQMLEGIWEVVYGE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |