C19H13Cl2FN2O2 — CID 8697484
N-(3-chloro-4-fluorophenyl)-1-[(3-chlorophenyl)methyl]-6-oxopyridine-3-carboxamide (PubChem CID 8697484) has the molecular formula C19H13Cl2FN2O2 and a molecular weight of 391.23 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-[(3-chlorophenyl)methyl]-6-oxopyridine-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-[(3-chlorophenyl)methyl]-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 8697484 |
| Molecular Formula | C19H13Cl2FN2O2 |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-[(3-chlorophenyl)methyl]-6-oxopyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1ccc(=O)n(Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C19H13Cl2FN2O2/c20-14-3-1-2-12(8-14)10-24-11-13(4-7-18(24)25)19(26)23-15-5-6-17(22)16(21)9-15/h1-9,11H,10H2,(H,23,26) |
| InChIKey | UZXZFQYIJDFPOO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |