About 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate
2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate (PubChem CID 86974886) has the molecular formula C17H19N3O3S2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate |
| PubChem CID | 86974886 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate |
| SMILES | CCN(CC)c1nc2sc(C(=O)OCCOc3cccnc3)cc2s1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-3-20(4-2)17-19-15-13(25-17)10-14(24-15)16(21)23-9-8-22-12-6-5-7-18-11-12/h5-7,10-11H,3-4,8-9H2,1-2H3 |
| InChIKey | QCAQDVIECYYHOX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The IUPAC name of 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate (CID 86974886) is 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate.
What is the SMILES notation for 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The canonical SMILES for 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate is CCN(CC)c1nc2sc(C(=O)OCCOc3cccnc3)cc2s1.
What is the InChIKey of 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The InChIKey is QCAQDVIECYYHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3S2/c1-3-20(4-2)17-19-15-13(25-17)10-14(24-15)16(21)23-9-8-22-12-6-5-7-18-11-12/h5-7,10-11H,3-4,8-9H2,1-2H3.
What are the key properties of 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate has a molecular weight of 377.49 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yloxyethyl 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate is sourced from PubChem (CID 86974886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).