methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate

C13H25NO3 — CID 86977052

IUPACmethyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate
SMILESCCC(C)C(NC(=O)CC(C)(C)C)C(=O)OC
InChIInChI=1S/C13H25NO3/c1-7-9(2)11(12(16)17-6)14-10(15)8-13(3,4)5/h9,11H,7-8H2,1-6H3,(H,14,15)
InChIKeyNJRZHKRYZADWRM-UHFFFAOYSA-N
MW243.35 g/mol
LogP2.13
Rot. Bonds5

About methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate

methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate (PubChem CID 86977052) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate.

Molecular Properties

Compound Namemethyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate
PubChem CID86977052
Molecular FormulaC13H25NO3
Molecular Weight243.35 g/mol
Exact Mass243.18
IUPAC Namemethyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate
SMILESCCC(C)C(NC(=O)CC(C)(C)C)C(=O)OC
InChIInChI=1S/C13H25NO3/c1-7-9(2)11(12(16)17-6)14-10(15)8-13(3,4)5/h9,11H,7-8H2,1-6H3,(H,14,15)
InChIKeyNJRZHKRYZADWRM-UHFFFAOYSA-N
XLogP2.13
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.35
LogP ≤ 52.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate?
The IUPAC name of methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate (CID 86977052) is methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate.
What is the SMILES notation for methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate?
The canonical SMILES for methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate is CCC(C)C(NC(=O)CC(C)(C)C)C(=O)OC.
What is the InChIKey of methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate?
The InChIKey is NJRZHKRYZADWRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-7-9(2)11(12(16)17-6)14-10(15)8-13(3,4)5/h9,11H,7-8H2,1-6H3,(H,14,15).
What are the key properties of methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate?
methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate has a molecular weight of 243.35 g/mol, XLogP of 2.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,3-dimethylbutanoylamino)-3-methylpentanoate is sourced from PubChem (CID 86977052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).