C17H28N2O4 — CID 86977195
methyl 2-[(1-cyclopentyl-5-oxopyrrolidine-3-carbonyl)amino]-3-methylpentanoate (PubChem CID 86977195) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl 2-[(1-cyclopentyl-5-oxopyrrolidine-3-carbonyl)amino]-3-methylpentanoate.
| Compound Name | methyl 2-[(1-cyclopentyl-5-oxopyrrolidine-3-carbonyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 86977195 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | methyl 2-[(1-cyclopentyl-5-oxopyrrolidine-3-carbonyl)amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)C1CC(=O)N(C2CCCC2)C1)C(=O)OC |
| InChI | InChI=1S/C17H28N2O4/c1-4-11(2)15(17(22)23-3)18-16(21)12-9-14(20)19(10-12)13-7-5-6-8-13/h11-13,15H,4-10H2,1-3H3,(H,18,21) |
| InChIKey | YMMGOURKMFUBGK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |