C18H19NOS2 — CID 86977726
4-(1,3-dithiolan-2-yl)-N-ethyl-N-phenylbenzamide (PubChem CID 86977726) has the molecular formula C18H19NOS2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-ethyl-N-phenylbenzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-ethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 86977726 |
| Molecular Formula | C18H19NOS2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-ethyl-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1ccc(C2SCCS2)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NOS2/c1-2-19(16-6-4-3-5-7-16)17(20)14-8-10-15(11-9-14)18-21-12-13-22-18/h3-11,18H,2,12-13H2,1H3 |
| InChIKey | IOQPHHPVKOIEQE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |