C14H13F3N2O3S — CID 86980074
2-(4-ethoxyphenoxy)-N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 86980074) has the molecular formula C14H13F3N2O3S and a molecular weight of 346.33 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 86980074 |
| Molecular Formula | C14H13F3N2O3S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCOc1ccc(OCC(=O)Nc2nc(C(F)(F)F)cs2)cc1 |
| InChI | InChI=1S/C14H13F3N2O3S/c1-2-21-9-3-5-10(6-4-9)22-7-12(20)19-13-18-11(8-23-13)14(15,16)17/h3-6,8H,2,7H2,1H3,(H,18,19,20) |
| InChIKey | YCOBFOBQJBYKJZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |