C21H26N2O2 — CID 86981703
N-[2-[[acetyl(ethyl)amino]methyl]phenyl]-3-phenylbutanamide (PubChem CID 86981703) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[2-[[acetyl(ethyl)amino]methyl]phenyl]-3-phenylbutanamide.
| Compound Name | N-[2-[[acetyl(ethyl)amino]methyl]phenyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 86981703 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[2-[[acetyl(ethyl)amino]methyl]phenyl]-3-phenylbutanamide |
| SMILES | CCN(Cc1ccccc1NC(=O)CC(C)c1ccccc1)C(C)=O |
| InChI | InChI=1S/C21H26N2O2/c1-4-23(17(3)24)15-19-12-8-9-13-20(19)22-21(25)14-16(2)18-10-6-5-7-11-18/h5-13,16H,4,14-15H2,1-3H3,(H,22,25) |
| InChIKey | AMJVXSNIADAVNN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |