About 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile
3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile (PubChem CID 86981959) has the molecular formula C19H14F3N3O3
and a molecular weight of 389.33 g/mol. Its IUPAC name is 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile.
Molecular Properties
| Compound Name | 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile |
| PubChem CID | 86981959 |
| Molecular Formula | C19H14F3N3O3 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile |
| SMILES | N#CC(C(=O)CCN1C(=O)COc2ccccc21)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H14F3N3O3/c20-19(21,22)12-5-6-14(24-10-12)13(9-23)16(26)7-8-25-15-3-1-2-4-17(15)28-11-18(25)27/h1-6,10,13H,7-8,11H2 |
| InChIKey | MUQBYZHDVXYVEL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile?
The IUPAC name of 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile (CID 86981959) is 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile.
What is the SMILES notation for 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile?
The canonical SMILES for 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile is N#CC(C(=O)CCN1C(=O)COc2ccccc21)c1ccc(C(F)(F)F)cn1.
What is the InChIKey of 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile?
The InChIKey is MUQBYZHDVXYVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N3O3/c20-19(21,22)12-5-6-14(24-10-12)13(9-23)16(26)7-8-25-15-3-1-2-4-17(15)28-11-18(25)27/h1-6,10,13H,7-8,11H2.
What are the key properties of 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile?
3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile has a molecular weight of 389.33 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)-2-[5-(trifluoromethyl)-2-pyridinyl]pentanenitrile is sourced from PubChem (CID 86981959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).