C15H23N3O3S — CID 86982166
2-[3-(methanesulfonamido)piperidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 86982166) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)piperidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[3-(methanesulfonamido)piperidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86982166 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[3-(methanesulfonamido)piperidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCCC(NS(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C15H23N3O3S/c1-12-5-3-6-13(9-12)16-15(19)11-18-8-4-7-14(10-18)17-22(2,20)21/h3,5-6,9,14,17H,4,7-8,10-11H2,1-2H3,(H,16,19) |
| InChIKey | FSGZNKYCOSFBNL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |