C24H19ClN2O2 — CID 8698220
N-(3-chloro-4-methylphenyl)-1-(naphthalen-1-ylmethyl)-6-oxopyridine-3-carboxamide (PubChem CID 8698220) has the molecular formula C24H19ClN2O2 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-1-(naphthalen-1-ylmethyl)-6-oxopyridine-3-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-1-(naphthalen-1-ylmethyl)-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 8698220 |
| Molecular Formula | C24H19ClN2O2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-1-(naphthalen-1-ylmethyl)-6-oxopyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(=O)n(Cc3cccc4ccccc34)c2)cc1Cl |
| InChI | InChI=1S/C24H19ClN2O2/c1-16-9-11-20(13-22(16)25)26-24(29)19-10-12-23(28)27(15-19)14-18-7-4-6-17-5-2-3-8-21(17)18/h2-13,15H,14H2,1H3,(H,26,29) |
| InChIKey | HGPMDRITICWKPA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |