C22H18FN3O2 — CID 86982252
3'-[(5-fluoroquinolin-8-yl)methyl]spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 86982252) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is 3'-[(5-fluoroquinolin-8-yl)methyl]spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[(5-fluoroquinolin-8-yl)methyl]spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 86982252 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3'-[(5-fluoroquinolin-8-yl)methyl]spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCc3ccccc3C2)C(=O)N1Cc1ccc(F)c2cccnc12 |
| InChI | InChI=1S/C22H18FN3O2/c23-18-8-7-16(19-17(18)6-3-11-24-19)13-26-20(27)22(25-21(26)28)10-9-14-4-1-2-5-15(14)12-22/h1-8,11H,9-10,12-13H2,(H,25,28) |
| InChIKey | WUNDEQALNCFNQH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|