C15H16Cl2N2O3 — CID 86982394
(2,6-dichlorophenyl) 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 86982394) has the molecular formula C15H16Cl2N2O3 and a molecular weight of 343.21 g/mol. Its IUPAC name is (2,6-dichlorophenyl) 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | (2,6-dichlorophenyl) 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 86982394 |
| Molecular Formula | C15H16Cl2N2O3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (2,6-dichlorophenyl) 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | CC(C)(C)c1noc(CCC(=O)Oc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C15H16Cl2N2O3/c1-15(2,3)14-18-11(22-19-14)7-8-12(20)21-13-9(16)5-4-6-10(13)17/h4-6H,7-8H2,1-3H3 |
| InChIKey | DRTBHMBVWNCRBD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|