C20H28N2O4S — CID 86982540
[1-(2-propylsulfonylbenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 86982540) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is [1-(2-propylsulfonylbenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(2-propylsulfonylbenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 86982540 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [1-(2-propylsulfonylbenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CCCS(=O)(=O)c1ccccc1C(=O)N1CCC(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H28N2O4S/c1-2-15-27(25,26)18-8-4-3-7-17(18)20(24)22-13-9-16(10-14-22)19(23)21-11-5-6-12-21/h3-4,7-8,16H,2,5-6,9-15H2,1H3 |
| InChIKey | DBOGHZBUKYXMOM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |