C15H19F3N2O4 — CID 86982612
methyl 2-methyl-2-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanoate (PubChem CID 86982612) has the molecular formula C15H19F3N2O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is methyl 2-methyl-2-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanoate.
| Compound Name | methyl 2-methyl-2-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 86982612 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl 2-methyl-2-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanoate |
| SMILES | CCCC(C)(NC(=O)Cn1cccc(C(F)(F)F)c1=O)C(=O)OC |
| InChI | InChI=1S/C15H19F3N2O4/c1-4-7-14(2,13(23)24-3)19-11(21)9-20-8-5-6-10(12(20)22)15(16,17)18/h5-6,8H,4,7,9H2,1-3H3,(H,19,21) |
| InChIKey | BKLCSEMYFVRPSE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |