C16H22N4OS — CID 86983680
2-[(2,2-dimethylmorpholin-4-yl)methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione (PubChem CID 86983680) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[(2,2-dimethylmorpholin-4-yl)methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2,2-dimethylmorpholin-4-yl)methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 86983680 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[(2,2-dimethylmorpholin-4-yl)methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-c2nc(=S)n(CN3CCOC(C)(C)C3)[nH]2)cc1 |
| InChI | InChI=1S/C16H22N4OS/c1-12-4-6-13(7-5-12)14-17-15(22)20(18-14)11-19-8-9-21-16(2,3)10-19/h4-7H,8-11H2,1-3H3,(H,17,18,22) |
| InChIKey | JHXDDCWUQOACAU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|