C19H20N6O2S — CID 86985401
1-(2,5-dimethylphenyl)-3-[3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanoylamino]thiourea (PubChem CID 86985401) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanoylamino]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 86985401 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanoylamino]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NNC(=O)CCc2nc(-c3ccccn3)no2)c1 |
| InChI | InChI=1S/C19H20N6O2S/c1-12-6-7-13(2)15(11-12)21-19(28)24-23-16(26)8-9-17-22-18(25-27-17)14-5-3-4-10-20-14/h3-7,10-11H,8-9H2,1-2H3,(H,23,26)(H2,21,24,28) |
| InChIKey | QXRJSHRZQXVPKT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|