About N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide
N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide (PubChem CID 86985711) has the molecular formula C20H18F2N4O
and a molecular weight of 368.39 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide |
| PubChem CID | 86985711 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)N(Cc3ccc(F)cc3F)C3CC3)nn2)cc1 |
| InChI | InChI=1S/C20H18F2N4O/c1-13-2-6-17(7-3-13)26-12-19(23-24-26)20(27)25(16-8-9-16)11-14-4-5-15(21)10-18(14)22/h2-7,10,12,16H,8-9,11H2,1H3 |
| InChIKey | CYUBAPXWOOHDAE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide?
The IUPAC name of N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide (CID 86985711) is N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide.
What is the SMILES notation for N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide?
The canonical SMILES for N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide is Cc1ccc(-n2cc(C(=O)N(Cc3ccc(F)cc3F)C3CC3)nn2)cc1.
What is the InChIKey of N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide?
The InChIKey is CYUBAPXWOOHDAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N4O/c1-13-2-6-17(7-3-13)26-12-19(23-24-26)20(27)25(16-8-9-16)11-14-4-5-15(21)10-18(14)22/h2-7,10,12,16H,8-9,11H2,1H3.
What are the key properties of N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide?
N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide has a molecular weight of 368.39 g/mol, XLogP of 3.66, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-[(2,4-difluorophenyl)methyl]-1-(4-methylphenyl)triazole-4-carboxamide is sourced from PubChem (CID 86985711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).