C13H22N2O3 — CID 86985859
N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-methylpropoxy)propanamide (PubChem CID 86985859) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-methylpropoxy)propanamide.
| Compound Name | N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-methylpropoxy)propanamide |
|---|---|
| PubChem CID | 86985859 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-methylpropoxy)propanamide |
| SMILES | Cc1cc(CN(C)C(=O)CCOCC(C)C)no1 |
| InChI | InChI=1S/C13H22N2O3/c1-10(2)9-17-6-5-13(16)15(4)8-12-7-11(3)18-14-12/h7,10H,5-6,8-9H2,1-4H3 |
| InChIKey | GYKMBXBWMNTQCN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|