C16H24N4O2 — CID 86986680
N-ethyl-2-[(4-piperidin-1-ylphenyl)carbamoylamino]acetamide (PubChem CID 86986680) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-ethyl-2-[(4-piperidin-1-ylphenyl)carbamoylamino]acetamide.
| Compound Name | N-ethyl-2-[(4-piperidin-1-ylphenyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 86986680 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-ethyl-2-[(4-piperidin-1-ylphenyl)carbamoylamino]acetamide |
| SMILES | CCNC(=O)CNC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H24N4O2/c1-2-17-15(21)12-18-16(22)19-13-6-8-14(9-7-13)20-10-4-3-5-11-20/h6-9H,2-5,10-12H2,1H3,(H,17,21)(H2,18,19,22) |
| InChIKey | JEIYVIAAHHIHPZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|