C17H21N3OS — CID 86986848
4-benzyl-N-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 86986848) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 4-benzyl-N-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | 4-benzyl-N-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86986848 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-benzyl-N-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | Cc1csc(NC(=O)N2CCC(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H21N3OS/c1-13-12-22-16(18-13)19-17(21)20-9-7-15(8-10-20)11-14-5-3-2-4-6-14/h2-6,12,15H,7-11H2,1H3,(H,18,19,21) |
| InChIKey | HRYJVVIWVCCSFK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |