About N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide
N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide (PubChem CID 8698737) has the molecular formula C14H21NO4S2
and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide |
| PubChem CID | 8698737 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@H]2COC3(CCCCC3)O2)s1 |
| InChI | InChI=1S/C14H21NO4S2/c1-11-5-6-13(20-11)21(16,17)15-9-12-10-18-14(19-12)7-3-2-4-8-14/h5-6,12,15H,2-4,7-10H2,1H3/t12-/m1/s1 |
| InChIKey | IUFDFOAURJQGLO-GFCCVEGCSA-N |
| XLogP | 2.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide?
The IUPAC name of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide (CID 8698737) is N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide.
What is the SMILES notation for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide?
The canonical SMILES for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide is Cc1ccc(S(=O)(=O)NC[C@@H]2COC3(CCCCC3)O2)s1.
What is the InChIKey of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide?
The InChIKey is IUFDFOAURJQGLO-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H21NO4S2/c1-11-5-6-13(20-11)21(16,17)15-9-12-10-18-14(19-12)7-3-2-4-8-14/h5-6,12,15H,2-4,7-10H2,1H3/t12-/m1/s1.
What are the key properties of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide?
N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide has a molecular weight of 331.46 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-5-methylthiophene-2-sulfonamide is sourced from PubChem (CID 8698737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).