C16H16F3N3O4 — CID 86988142
N-[4-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 86988142) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is N-[4-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86988142 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[4-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)NCC(O)c2ccco2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3N3O4/c1-9(23)21-10-4-5-12(11(7-10)16(17,18)19)22-15(25)20-8-13(24)14-3-2-6-26-14/h2-7,13,24H,8H2,1H3,(H,21,23)(H2,20,22,25) |
| InChIKey | WOKCVLDAMQKUCG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |