C22H24N2O4 — CID 8698874
[2-(4-acetylanilino)-2-oxoethyl] (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate (PubChem CID 8698874) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8698874 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)/C=C/c2cc(C)n(C3CC3)c2C)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-14-12-18(15(2)24(14)20-9-10-20)6-11-22(27)28-13-21(26)23-19-7-4-17(5-8-19)16(3)25/h4-8,11-12,20H,9-10,13H2,1-3H3,(H,23,26)/b11-6+ |
| InChIKey | MTXLRXHHTZACQM-IZZDOVSWSA-N |
| XLogP | 3.84 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|