C19H17BrN2O — CID 8698923
6-(3-bromophenyl)-2-[(2,5-dimethylphenyl)methyl]pyridazin-3-one (PubChem CID 8698923) has the molecular formula C19H17BrN2O and a molecular weight of 369.26 g/mol. Its IUPAC name is 6-(3-bromophenyl)-2-[(2,5-dimethylphenyl)methyl]pyridazin-3-one.
| Compound Name | 6-(3-bromophenyl)-2-[(2,5-dimethylphenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 8698923 |
| Molecular Formula | C19H17BrN2O |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 6-(3-bromophenyl)-2-[(2,5-dimethylphenyl)methyl]pyridazin-3-one |
| SMILES | Cc1ccc(C)c(Cn2nc(-c3cccc(Br)c3)ccc2=O)c1 |
| InChI | InChI=1S/C19H17BrN2O/c1-13-6-7-14(2)16(10-13)12-22-19(23)9-8-18(21-22)15-4-3-5-17(20)11-15/h3-11H,12H2,1-2H3 |
| InChIKey | MYEARBAOUNGRDW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |