C20H21N3O — CID 86990135
N-[(1-benzylpyrazol-4-yl)methyl]-2-(4-methylphenyl)acetamide (PubChem CID 86990135) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[(1-benzylpyrazol-4-yl)methyl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[(1-benzylpyrazol-4-yl)methyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86990135 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[(1-benzylpyrazol-4-yl)methyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)NCc2cnn(Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C20H21N3O/c1-16-7-9-17(10-8-16)11-20(24)21-12-19-13-22-23(15-19)14-18-5-3-2-4-6-18/h2-10,13,15H,11-12,14H2,1H3,(H,21,24) |
| InChIKey | RNMZLDCRUACAEA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |