C19H22FNO3 — CID 86990942
2-(4-fluorophenoxy)-N-[[3-(methoxymethyl)phenyl]methyl]-2-methylpropanamide (PubChem CID 86990942) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[[3-(methoxymethyl)phenyl]methyl]-2-methylpropanamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[[3-(methoxymethyl)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 86990942 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[[3-(methoxymethyl)phenyl]methyl]-2-methylpropanamide |
| SMILES | COCc1cccc(CNC(=O)C(C)(C)Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H22FNO3/c1-19(2,24-17-9-7-16(20)8-10-17)18(22)21-12-14-5-4-6-15(11-14)13-23-3/h4-11H,12-13H2,1-3H3,(H,21,22) |
| InChIKey | IZZBQNRFHWCEPK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |