C20H25ClN4O2 — CID 86992830
1-[2-(4-chlorophenyl)ethyl]-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]urea (PubChem CID 86992830) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 86992830 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]urea |
| SMILES | CC1CN(c2ccc(CNC(=O)NCCc3ccc(Cl)cc3)cn2)CCO1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-15-14-25(10-11-27-15)19-7-4-17(12-23-19)13-24-20(26)22-9-8-16-2-5-18(21)6-3-16/h2-7,12,15H,8-11,13-14H2,1H3,(H2,22,24,26) |
| InChIKey | WWBDFXCYMCQZNO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |