C23H17N3O2 — CID 8699316
N-(9H-fluoren-3-yl)-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 8699316) has the molecular formula C23H17N3O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(9H-fluoren-3-yl)-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-(9H-fluoren-3-yl)-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 8699316 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-(9H-fluoren-3-yl)-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc3c(c2)-c2ccccc2C3)c2ccccc2c1=O |
| InChI | InChI=1S/C23H17N3O2/c1-26-23(28)19-9-5-4-8-18(19)21(25-26)22(27)24-16-11-10-15-12-14-6-2-3-7-17(14)20(15)13-16/h2-11,13H,12H2,1H3,(H,24,27) |
| InChIKey | VNUFOMLVULYQML-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |