C14H28N4O3 — CID 86993819
N-ethyl-2-[(3-methyl-2-morpholin-4-ylbutyl)carbamoylamino]acetamide (PubChem CID 86993819) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-ethyl-2-[(3-methyl-2-morpholin-4-ylbutyl)carbamoylamino]acetamide.
| Compound Name | N-ethyl-2-[(3-methyl-2-morpholin-4-ylbutyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 86993819 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-ethyl-2-[(3-methyl-2-morpholin-4-ylbutyl)carbamoylamino]acetamide |
| SMILES | CCNC(=O)CNC(=O)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C14H28N4O3/c1-4-15-13(19)10-17-14(20)16-9-12(11(2)3)18-5-7-21-8-6-18/h11-12H,4-10H2,1-3H3,(H,15,19)(H2,16,17,20) |
| InChIKey | JAZNDQOUTXHITC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |