C17H33N3O2S — CID 86994380
N-[3-(diethylamino)propyl]-1-(2-methylsulfanylpropanoyl)piperidine-4-carboxamide (PubChem CID 86994380) has the molecular formula C17H33N3O2S and a molecular weight of 343.54 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-(2-methylsulfanylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-(2-methylsulfanylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86994380 |
| Molecular Formula | C17H33N3O2S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-(2-methylsulfanylpropanoyl)piperidine-4-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCN(C(=O)C(C)SC)CC1 |
| InChI | InChI=1S/C17H33N3O2S/c1-5-19(6-2)11-7-10-18-16(21)15-8-12-20(13-9-15)17(22)14(3)23-4/h14-15H,5-13H2,1-4H3,(H,18,21) |
| InChIKey | NXELWDKQBICMQS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|