About 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea
1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 86995183) has the molecular formula C18H16ClF3N4O
and a molecular weight of 396.80 g/mol. Its IUPAC name is 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea.
Molecular Properties
| Compound Name | 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea |
| PubChem CID | 86995183 |
| Molecular Formula | C18H16ClF3N4O |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)NCc1cn2cc(Cl)ccc2n1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16ClF3N4O/c1-11(12-2-4-13(5-3-12)18(20,21)22)24-17(27)23-8-15-10-26-9-14(19)6-7-16(26)25-15/h2-7,9-11H,8H2,1H3,(H2,23,24,27) |
| InChIKey | XDGXXWDBMLCYCJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea?
The IUPAC name of 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea (CID 86995183) is 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea.
What is the SMILES notation for 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea?
The canonical SMILES for 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea is CC(NC(=O)NCc1cn2cc(Cl)ccc2n1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea?
The InChIKey is XDGXXWDBMLCYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClF3N4O/c1-11(12-2-4-13(5-3-12)18(20,21)22)24-17(27)23-8-15-10-26-9-14(19)6-7-16(26)25-15/h2-7,9-11H,8H2,1H3,(H2,23,24,27).
What are the key properties of 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea?
1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea has a molecular weight of 396.80 g/mol, XLogP of 4.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea is sourced from PubChem (CID 86995183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).