C17H15F3N2O4 — CID 86995659
N'-[3-(difluoromethoxy)-4-methoxyphenyl]-N-[(4-fluorophenyl)methyl]oxamide (PubChem CID 86995659) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is N'-[3-(difluoromethoxy)-4-methoxyphenyl]-N-[(4-fluorophenyl)methyl]oxamide.
| Compound Name | N'-[3-(difluoromethoxy)-4-methoxyphenyl]-N-[(4-fluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 86995659 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N'-[3-(difluoromethoxy)-4-methoxyphenyl]-N-[(4-fluorophenyl)methyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCc2ccc(F)cc2)cc1OC(F)F |
| InChI | InChI=1S/C17H15F3N2O4/c1-25-13-7-6-12(8-14(13)26-17(19)20)22-16(24)15(23)21-9-10-2-4-11(18)5-3-10/h2-8,17H,9H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | BCKLRXFKYWDXQS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|