C18H15ClF2N2O4 — CID 86995788
methyl 5-[[2-[1-(2-chlorophenyl)ethylamino]-2-oxoacetyl]amino]-2,4-difluorobenzoate (PubChem CID 86995788) has the molecular formula C18H15ClF2N2O4 and a molecular weight of 396.78 g/mol. Its IUPAC name is methyl 5-[[2-[1-(2-chlorophenyl)ethylamino]-2-oxoacetyl]amino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[[2-[1-(2-chlorophenyl)ethylamino]-2-oxoacetyl]amino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 86995788 |
| Molecular Formula | C18H15ClF2N2O4 |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | methyl 5-[[2-[1-(2-chlorophenyl)ethylamino]-2-oxoacetyl]amino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)C(=O)NC(C)c2ccccc2Cl)c(F)cc1F |
| InChI | InChI=1S/C18H15ClF2N2O4/c1-9(10-5-3-4-6-12(10)19)22-16(24)17(25)23-15-7-11(18(26)27-2)13(20)8-14(15)21/h3-9H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | WNQTUXGHDGUCFE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|