About (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate
(3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate (PubChem CID 86998341) has the molecular formula C17H13N3O3
and a molecular weight of 307.31 g/mol. Its IUPAC name is (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate |
| PubChem CID | 86998341 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate |
| SMILES | NC(=O)c1cccc(OC(=O)c2cnn(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C17H13N3O3/c18-16(21)12-5-4-8-15(9-12)23-17(22)13-10-19-20(11-13)14-6-2-1-3-7-14/h1-11H,(H2,18,21) |
| InChIKey | WIVRSBQDWVGGGR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate?
The IUPAC name of (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate (CID 86998341) is (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate.
What is the SMILES notation for (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate?
The canonical SMILES for (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate is NC(=O)c1cccc(OC(=O)c2cnn(-c3ccccc3)c2)c1.
What is the InChIKey of (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate?
The InChIKey is WIVRSBQDWVGGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O3/c18-16(21)12-5-4-8-15(9-12)23-17(22)13-10-19-20(11-13)14-6-2-1-3-7-14/h1-11H,(H2,18,21).
What are the key properties of (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate?
(3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate has a molecular weight of 307.31 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamoylphenyl) 1-phenylpyrazole-4-carboxylate is sourced from PubChem (CID 86998341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).