About 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide
4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 86998665) has the molecular formula C15H16N2OS3
and a molecular weight of 336.51 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 86998665 |
| Molecular Formula | C15H16N2OS3 |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(N(C)C(=O)c2ccc(C3SCCS3)cc2)n1 |
| InChI | InChI=1S/C15H16N2OS3/c1-10-9-21-15(16-10)17(2)13(18)11-3-5-12(6-4-11)14-19-7-8-20-14/h3-6,9,14H,7-8H2,1-2H3 |
| InChIKey | YLAWWLLDEMGOQN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide (CID 86998665) is 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide is Cc1csc(N(C)C(=O)c2ccc(C3SCCS3)cc2)n1.
What is the InChIKey of 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is YLAWWLLDEMGOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2OS3/c1-10-9-21-15(16-10)17(2)13(18)11-3-5-12(6-4-11)14-19-7-8-20-14/h3-6,9,14H,7-8H2,1-2H3.
What are the key properties of 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide?
4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 336.51 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dithiolan-2-yl)-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 86998665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).